C17H10BrF3N2O — CID 1268582
(Z)-3-(3-bromophenyl)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 1268582) has the molecular formula C17H10BrF3N2O and a molecular weight of 395.18 g/mol. Its IUPAC name is (Z)-3-(3-bromophenyl)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-3-(3-bromophenyl)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 1268582 |
| Molecular Formula | C17H10BrF3N2O |
| Molecular Weight | 395.18 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | (Z)-3-(3-bromophenyl)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cccc(Br)c1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H10BrF3N2O/c18-14-5-1-3-11(8-14)7-12(10-22)16(24)23-15-6-2-4-13(9-15)17(19,20)21/h1-9H,(H,23,24)/b12-7- |
| InChIKey | NYNQFOXLYUATTI-GHXNOFRVSA-N |
| XLogP | 5.01 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.18 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|