C18H11F3N2O3 — CID 4006884
3-[[2-cyano-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 4006884) has the molecular formula C18H11F3N2O3 and a molecular weight of 360.29 g/mol. Its IUPAC name is 3-[[2-cyano-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[2-cyano-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 4006884 |
| Molecular Formula | C18H11F3N2O3 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 3-[[2-cyano-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | N#CC(=Cc1cccc(C(F)(F)F)c1)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H11F3N2O3/c19-18(20,21)14-5-1-3-11(8-14)7-13(10-22)16(24)23-15-6-2-4-12(9-15)17(25)26/h1-9H,(H,23,24)(H,25,26) |
| InChIKey | DGDCLAHQYVZTBW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|