C17H9Br2F3N2O2 — CID 4098860
2-cyano-3-(3,5-dibromo-4-hydroxyphenyl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 4098860) has the molecular formula C17H9Br2F3N2O2 and a molecular weight of 490.07 g/mol. Its IUPAC name is 2-cyano-3-(3,5-dibromo-4-hydroxyphenyl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | 2-cyano-3-(3,5-dibromo-4-hydroxyphenyl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4098860 |
| Molecular Formula | C17H9Br2F3N2O2 |
| Molecular Weight | 490.07 g/mol |
| Exact Mass | 487.90 |
| IUPAC Name | 2-cyano-3-(3,5-dibromo-4-hydroxyphenyl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#CC(=Cc1cc(Br)c(O)c(Br)c1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9Br2F3N2O2/c18-13-5-9(6-14(19)15(13)25)4-10(8-23)16(26)24-12-3-1-2-11(7-12)17(20,21)22/h1-7,25H,(H,24,26) |
| InChIKey | IXZCLYJWALRSNO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.07 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|