C27H20Br2F3N3O3 — CID 126255594
(E)-2-cyano-3-[3,5-dibromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126255594) has the molecular formula C27H20Br2F3N3O3 and a molecular weight of 651.28 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dibromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dibromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126255594 |
| Molecular Formula | C27H20Br2F3N3O3 |
| Molecular Weight | 651.28 g/mol |
| Exact Mass | 648.98 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dibromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Br)cc(/C=C(\C#N)C(=O)Nc3cccc(C(F)(F)F)c3)cc2Br)cc1C |
| InChI | InChI=1S/C27H20Br2F3N3O3/c1-15-6-7-21(8-16(15)2)34-24(36)14-38-25-22(28)10-17(11-23(25)29)9-18(13-33)26(37)35-20-5-3-4-19(12-20)27(30,31)32/h3-12H,14H2,1-2H3,(H,34,36)(H,35,37)/b18-9+ |
| InChIKey | IBYKMALAQINAIK-GIJQJNRQSA-N |
| XLogP | 7.41 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.28 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|