C30H30BrN3O4 — CID 126256108
(Z)-3-[3-bromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide (PubChem CID 126256108) has the molecular formula C30H30BrN3O4 and a molecular weight of 576.49 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126256108 |
| Molecular Formula | C30H30BrN3O4 |
| Molecular Weight | 576.49 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | (Z)-3-[3-bromo-4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2cccc(C)c2C)cc(Br)c1OCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C30H30BrN3O4/c1-6-37-27-15-22(13-23(16-32)30(36)34-26-9-7-8-19(3)21(26)5)14-25(31)29(27)38-17-28(35)33-24-11-10-18(2)20(4)12-24/h7-15H,6,17H2,1-5H3,(H,33,35)(H,34,36)/b23-13- |
| InChIKey | JXNMKVLEWJATGR-QRVIBDJDSA-N |
| XLogP | 6.64 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.49 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|