C26H20Br2ClN3O3 — CID 126275379
(Z)-N-(4-chlorophenyl)-2-cyano-3-[3,5-dibromo-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]phenyl]prop-2-enamide (PubChem CID 126275379) has the molecular formula C26H20Br2ClN3O3 and a molecular weight of 617.73 g/mol. Its IUPAC name is (Z)-N-(4-chlorophenyl)-2-cyano-3-[3,5-dibromo-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]phenyl]prop-2-enamide.
| Compound Name | (Z)-N-(4-chlorophenyl)-2-cyano-3-[3,5-dibromo-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126275379 |
| Molecular Formula | C26H20Br2ClN3O3 |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 614.96 |
| IUPAC Name | (Z)-N-(4-chlorophenyl)-2-cyano-3-[3,5-dibromo-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]phenyl]prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)COc2c(Br)cc(/C=C(/C#N)C(=O)Nc3ccc(Cl)cc3)cc2Br)c1C |
| InChI | InChI=1S/C26H20Br2ClN3O3/c1-15-4-3-5-23(16(15)2)32-24(33)14-35-25-21(27)11-17(12-22(25)28)10-18(13-30)26(34)31-20-8-6-19(29)7-9-20/h3-12H,14H2,1-2H3,(H,31,34)(H,32,33)/b18-10- |
| InChIKey | HDJDERNQSVPQNZ-ZDLGFXPLSA-N |
| XLogP | 7.05 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|