C27H23BrClN3O4 — CID 126254886
(Z)-3-[3-bromo-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]-N-(4-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 126254886) has the molecular formula C27H23BrClN3O4 and a molecular weight of 568.86 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]-N-(4-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]-N-(4-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126254886 |
| Molecular Formula | C27H23BrClN3O4 |
| Molecular Weight | 568.86 g/mol |
| Exact Mass | 567.06 |
| IUPAC Name | (Z)-3-[3-bromo-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]-N-(4-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2ccc(Cl)cc2)cc(Br)c1OCC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C27H23BrClN3O4/c1-16-5-4-6-23(17(16)2)32-25(33)15-36-26-22(28)12-18(13-24(26)35-3)11-19(14-30)27(34)31-21-9-7-20(29)8-10-21/h4-13H,15H2,1-3H3,(H,31,34)(H,32,33)/b19-11- |
| InChIKey | FNLMCRZCOIKURX-ODLFYWEKSA-N |
| XLogP | 6.29 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.86 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|