C28H26BrN3O5 — CID 126272404
(E)-3-[3-bromo-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 126272404) has the molecular formula C28H26BrN3O5 and a molecular weight of 564.44 g/mol. Its IUPAC name is (E)-3-[3-bromo-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126272404 |
| Molecular Formula | C28H26BrN3O5 |
| Molecular Weight | 564.44 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | (E)-3-[3-bromo-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(NC(=O)/C(C#N)=C/c2cc(Br)c(OCC(=O)Nc3ccccc3C)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H26BrN3O5/c1-4-36-22-11-9-21(10-12-22)31-28(34)20(16-30)13-19-14-23(29)27(25(15-19)35-3)37-17-26(33)32-24-8-6-5-7-18(24)2/h5-15H,4,17H2,1-3H3,(H,31,34)(H,32,33)/b20-13+ |
| InChIKey | PJIBJEODZRVPEI-DEDYPNTBSA-N |
| XLogP | 5.73 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|