C26H22BrN3O5 — CID 126382850
(E)-3-[3-bromo-5-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-phenylprop-2-enamide (PubChem CID 126382850) has the molecular formula C26H22BrN3O5 and a molecular weight of 536.38 g/mol. Its IUPAC name is (E)-3-[3-bromo-5-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-phenylprop-2-enamide.
| Compound Name | (E)-3-[3-bromo-5-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 126382850 |
| Molecular Formula | C26H22BrN3O5 |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | (E)-3-[3-bromo-5-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-phenylprop-2-enamide |
| SMILES | COc1ccc(NC(=O)COc2c(Br)cc(/C=C(\C#N)C(=O)Nc3ccccc3)cc2OC)cc1 |
| InChI | InChI=1S/C26H22BrN3O5/c1-33-21-10-8-20(9-11-21)29-24(31)16-35-25-22(27)13-17(14-23(25)34-2)12-18(15-28)26(32)30-19-6-4-3-5-7-19/h3-14H,16H2,1-2H3,(H,29,31)(H,30,32)/b18-12+ |
| InChIKey | OFFHFMRHTYJXGM-LDADJPATSA-N |
| XLogP | 5.03 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|