C21H19BrN2O5 — CID 19580236
ethyl (E)-3-[4-(2-anilino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]-2-cyanoprop-2-enoate (PubChem CID 19580236) has the molecular formula C21H19BrN2O5 and a molecular weight of 459.30 g/mol. Its IUPAC name is ethyl (E)-3-[4-(2-anilino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(2-anilino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 19580236 |
| Molecular Formula | C21H19BrN2O5 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | ethyl (E)-3-[4-(2-anilino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1cc(Br)c(OCC(=O)Nc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C21H19BrN2O5/c1-3-28-21(26)15(12-23)9-14-10-17(22)20(18(11-14)27-2)29-13-19(25)24-16-7-5-4-6-8-16/h4-11H,3,13H2,1-2H3,(H,24,25)/b15-9+ |
| InChIKey | GJVGTDDLPAFOOB-OQLLNIDSSA-N |
| XLogP | 3.95 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|