C22H21BrN4O5 — CID 126239336
(Z)-3-[3-bromo-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-N-carbamoyl-2-cyanoprop-2-enamide (PubChem CID 126239336) has the molecular formula C22H21BrN4O5 and a molecular weight of 501.34 g/mol. Its IUPAC name is (Z)-3-[3-bromo-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-N-carbamoyl-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-N-carbamoyl-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126239336 |
| Molecular Formula | C22H21BrN4O5 |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | (Z)-3-[3-bromo-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-N-carbamoyl-2-cyanoprop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)NC(N)=O)cc(Br)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C22H21BrN4O5/c1-3-31-18-10-14(8-15(11-24)21(29)27-22(25)30)9-17(23)20(18)32-12-19(28)26-16-6-4-13(2)5-7-16/h4-10H,3,12H2,1-2H3,(H,26,28)(H3,25,27,29,30)/b15-8- |
| InChIKey | QZSYORUDTSDVLI-NVNXTCNLSA-N |
| XLogP | 3.28 |
| TPSA | 143.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|