C27H24ClN3O5 — CID 126387965
(E)-3-[3-chloro-5-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-methylphenyl)prop-2-enamide (PubChem CID 126387965) has the molecular formula C27H24ClN3O5 and a molecular weight of 505.96 g/mol. Its IUPAC name is (E)-3-[3-chloro-5-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-chloro-5-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126387965 |
| Molecular Formula | C27H24ClN3O5 |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | (E)-3-[3-chloro-5-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-methylphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)COc2c(Cl)cc(/C=C(\C#N)C(=O)Nc3cccc(C)c3)cc2OC)cc1 |
| InChI | InChI=1S/C27H24ClN3O5/c1-17-5-4-6-21(11-17)31-27(33)19(15-29)12-18-13-23(28)26(24(14-18)35-3)36-16-25(32)30-20-7-9-22(34-2)10-8-20/h4-14H,16H2,1-3H3,(H,30,32)(H,31,33)/b19-12+ |
| InChIKey | XHZMDJQWFVMVOJ-XDHOZWIPSA-N |
| XLogP | 5.23 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|