C25H20ClN3O5 — CID 126052585
(E)-3-[4-(2-anilino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 126052585) has the molecular formula C25H20ClN3O5 and a molecular weight of 477.90 g/mol. Its IUPAC name is (E)-3-[4-(2-anilino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(2-anilino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126052585 |
| Molecular Formula | C25H20ClN3O5 |
| Molecular Weight | 477.90 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | (E)-3-[4-(2-anilino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2ccc(O)cc2)cc(Cl)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H20ClN3O5/c1-33-22-13-16(11-17(14-27)25(32)29-19-7-9-20(30)10-8-19)12-21(26)24(22)34-15-23(31)28-18-5-3-2-4-6-18/h2-13,30H,15H2,1H3,(H,28,31)(H,29,32)/b17-11+ |
| InChIKey | JFGLFRPSWXTMRO-GZTJUZNOSA-N |
| XLogP | 4.62 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|