C20H17ClN2O6 — CID 3643245
methyl 2-[2-chloro-4-[2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]-6-methoxyphenoxy]acetate (PubChem CID 3643245) has the molecular formula C20H17ClN2O6 and a molecular weight of 416.82 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-[2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-chloro-4-[2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3643245 |
| Molecular Formula | C20H17ClN2O6 |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | methyl 2-[2-chloro-4-[2-cyano-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)cc(C=C(C#N)C(=O)Nc2ccc(O)cc2)cc1OC |
| InChI | InChI=1S/C20H17ClN2O6/c1-27-17-9-12(8-16(21)19(17)29-11-18(25)28-2)7-13(10-22)20(26)23-14-3-5-15(24)6-4-14/h3-9,24H,11H2,1-2H3,(H,23,26) |
| InChIKey | WBPVXLBEAJWWME-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|