C25H28Cl2N2O3 — CID 124542415
(Z)-3-(3-chloro-5-methoxy-4-octoxyphenyl)-N-(4-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 124542415) has the molecular formula C25H28Cl2N2O3 and a molecular weight of 475.42 g/mol. Its IUPAC name is (Z)-3-(3-chloro-5-methoxy-4-octoxyphenyl)-N-(4-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(3-chloro-5-methoxy-4-octoxyphenyl)-N-(4-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 124542415 |
| Molecular Formula | C25H28Cl2N2O3 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (Z)-3-(3-chloro-5-methoxy-4-octoxyphenyl)-N-(4-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | CCCCCCCCOc1c(Cl)cc(/C=C(/C#N)C(=O)Nc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C25H28Cl2N2O3/c1-3-4-5-6-7-8-13-32-24-22(27)15-18(16-23(24)31-2)14-19(17-28)25(30)29-21-11-9-20(26)10-12-21/h9-12,14-16H,3-8,13H2,1-2H3,(H,29,30)/b19-14- |
| InChIKey | DMDWDLSWRHZLHB-RGEXLXHISA-N |
| XLogP | 7.29 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|