C25H29ClN2O3 — CID 6064826
(E)-3-(3-chloro-4-hexoxy-5-methoxyphenyl)-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 6064826) has the molecular formula C25H29ClN2O3 and a molecular weight of 440.97 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-hexoxy-5-methoxyphenyl)-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-hexoxy-5-methoxyphenyl)-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6064826 |
| Molecular Formula | C25H29ClN2O3 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (E)-3-(3-chloro-4-hexoxy-5-methoxyphenyl)-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | CCCCCCOc1c(Cl)cc(/C=C(\C#N)C(=O)Nc2ccc(C)cc2C)cc1OC |
| InChI | InChI=1S/C25H29ClN2O3/c1-5-6-7-8-11-31-24-21(26)14-19(15-23(24)30-4)13-20(16-27)25(29)28-22-10-9-17(2)12-18(22)3/h9-10,12-15H,5-8,11H2,1-4H3,(H,28,29)/b20-13+ |
| InChIKey | FUKMDNIGSKILBQ-DEDYPNTBSA-N |
| XLogP | 6.47 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|