C22H22Cl2N2O3 — CID 4504067
2-cyano-N-(2,3-dichlorophenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide (PubChem CID 4504067) has the molecular formula C22H22Cl2N2O3 and a molecular weight of 433.34 g/mol. Its IUPAC name is 2-cyano-N-(2,3-dichlorophenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide.
| Compound Name | 2-cyano-N-(2,3-dichlorophenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4504067 |
| Molecular Formula | C22H22Cl2N2O3 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-cyano-N-(2,3-dichlorophenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide |
| SMILES | CCCCCOc1ccc(C=C(C#N)C(=O)Nc2cccc(Cl)c2Cl)cc1OC |
| InChI | InChI=1S/C22H22Cl2N2O3/c1-3-4-5-11-29-19-10-9-15(13-20(19)28-2)12-16(14-25)22(27)26-18-8-6-7-17(23)21(18)24/h6-10,12-13H,3-5,11H2,1-2H3,(H,26,27) |
| InChIKey | KFFDBZUJXFBTQU-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|