C23H25BrN2O3 — CID 19172479
(E)-N-(3-bromophenyl)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 19172479) has the molecular formula C23H25BrN2O3 and a molecular weight of 457.37 g/mol. Its IUPAC name is (E)-N-(3-bromophenyl)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(3-bromophenyl)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19172479 |
| Molecular Formula | C23H25BrN2O3 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (E)-N-(3-bromophenyl)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCOc1ccc(/C=C(\C#N)C(=O)Nc2cccc(Br)c2)cc1OC |
| InChI | InChI=1S/C23H25BrN2O3/c1-3-4-5-6-12-29-21-11-10-17(14-22(21)28-2)13-18(16-25)23(27)26-20-9-7-8-19(24)15-20/h7-11,13-15H,3-6,12H2,1-2H3,(H,26,27)/b18-13+ |
| InChIKey | SNUDZEZKIRPDTK-QGOAFFKASA-N |
| XLogP | 5.96 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|