C24H27N3O4 — CID 19172260
2-[[(E)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzamide (PubChem CID 19172260) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[[(E)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | 2-[[(E)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 19172260 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-[[(E)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzamide |
| SMILES | CCCCCCOc1ccc(/C=C(\C#N)C(=O)Nc2ccccc2C(N)=O)cc1OC |
| InChI | InChI=1S/C24H27N3O4/c1-3-4-5-8-13-31-21-12-11-17(15-22(21)30-2)14-18(16-25)24(29)27-20-10-7-6-9-19(20)23(26)28/h6-7,9-12,14-15H,3-5,8,13H2,1-2H3,(H2,26,28)(H,27,29)/b18-14+ |
| InChIKey | WDWGUJDHHWELPA-NBVRZTHBSA-N |
| XLogP | 4.30 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|