C18H17N3O3 — CID 24766984
(E)-N-(2-aminophenyl)-2-cyano-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 24766984) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-2-cyano-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-2-cyano-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24766984 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (E)-N-(2-aminophenyl)-2-cyano-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)Nc2ccccc2N)cc1OC |
| InChI | InChI=1S/C18H17N3O3/c1-23-16-8-7-12(10-17(16)24-2)9-13(11-19)18(22)21-15-6-4-3-5-14(15)20/h3-10H,20H2,1-2H3,(H,21,22)/b13-9+ |
| InChIKey | UEFRUYPLOJAHAQ-UKTHLTGXSA-N |
| XLogP | 2.83 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|