C20H19N3O4 — CID 19172858
2-[[(E)-2-cyano-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzamide (PubChem CID 19172858) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-[[(E)-2-cyano-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | 2-[[(E)-2-cyano-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 19172858 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[[(E)-2-cyano-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzamide |
| SMILES | CCOc1ccc(/C=C(\C#N)C(=O)Nc2ccccc2C(N)=O)cc1OC |
| InChI | InChI=1S/C20H19N3O4/c1-3-27-17-9-8-13(11-18(17)26-2)10-14(12-21)20(25)23-16-7-5-4-6-15(16)19(22)24/h4-11H,3H2,1-2H3,(H2,22,24)(H,23,25)/b14-10+ |
| InChIKey | IRHOPRYJEPDQPI-GXDHUFHOSA-N |
| XLogP | 2.74 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|