C26H24N2O7 — CID 31330018
methyl 5-[[4-[(E)-2-cyano-3-(2-ethoxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate (PubChem CID 31330018) has the molecular formula C26H24N2O7 and a molecular weight of 476.49 g/mol. Its IUPAC name is methyl 5-[[4-[(E)-2-cyano-3-(2-ethoxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[(E)-2-cyano-3-(2-ethoxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 31330018 |
| Molecular Formula | C26H24N2O7 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | methyl 5-[[4-[(E)-2-cyano-3-(2-ethoxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
| SMILES | CCOc1ccccc1NC(=O)/C(C#N)=C/c1ccc(OCc2ccc(C(=O)OC)o2)c(OC)c1 |
| InChI | InChI=1S/C26H24N2O7/c1-4-33-21-8-6-5-7-20(21)28-25(29)18(15-27)13-17-9-11-22(24(14-17)31-2)34-16-19-10-12-23(35-19)26(30)32-3/h5-14H,4,16H2,1-3H3,(H,28,29)/b18-13+ |
| InChIKey | CVLXNCHMXHHETO-QGOAFFKASA-N |
| XLogP | 4.60 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|