C24H19BrN2O6 — CID 3946798
methyl 5-[[4-[3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate (PubChem CID 3946798) has the molecular formula C24H19BrN2O6 and a molecular weight of 511.33 g/mol. Its IUPAC name is methyl 5-[[4-[3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3946798 |
| Molecular Formula | C24H19BrN2O6 |
| Molecular Weight | 511.33 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | methyl 5-[[4-[3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COc2ccc(C=C(C#N)C(=O)Nc3ccc(Br)cc3)cc2OC)o1 |
| InChI | InChI=1S/C24H19BrN2O6/c1-30-22-12-15(11-16(13-26)23(28)27-18-6-4-17(25)5-7-18)3-9-20(22)32-14-19-8-10-21(33-19)24(29)31-2/h3-12H,14H2,1-2H3,(H,27,28) |
| InChIKey | LRAVKNORNSOHRL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 110.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|