C20H17BrN2O5 — CID 126017316
(2S)-2-[4-[(Z)-3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 126017316) has the molecular formula C20H17BrN2O5 and a molecular weight of 445.27 g/mol. Its IUPAC name is (2S)-2-[4-[(Z)-3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[(Z)-3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126017316 |
| Molecular Formula | C20H17BrN2O5 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | (2S)-2-[4-[(Z)-3-(4-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2ccc(Br)cc2)ccc1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C20H17BrN2O5/c1-12(20(25)26)28-17-8-3-13(10-18(17)27-2)9-14(11-22)19(24)23-16-6-4-15(21)5-7-16/h3-10,12H,1-2H3,(H,23,24)(H,25,26)/b14-9-/t12-/m0/s1 |
| InChIKey | DHFRNFPDYZRPNX-CJAAZZPWSA-N |
| XLogP | 3.86 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|