C20H18N2O6 — CID 1118783
2-[4-[2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetic acid (PubChem CID 1118783) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is 2-[4-[2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 1118783 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[4-[2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1ccc(NC(=O)C(C#N)=Cc2ccc(OCC(=O)O)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H18N2O6/c1-26-16-6-4-15(5-7-16)22-20(25)14(11-21)9-13-3-8-17(18(10-13)27-2)28-12-19(23)24/h3-10H,12H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | BHUSBKLCFDFRDX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|