C19H14ClN2O5- — CID 2208598
2-[4-[(E)-3-(4-chloroanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate (PubChem CID 2208598) has the molecular formula C19H14ClN2O5- and a molecular weight of 385.78 g/mol. Its IUPAC name is 2-[4-[(E)-3-(4-chloroanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate.
| Compound Name | 2-[4-[(E)-3-(4-chloroanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 2208598 |
| Molecular Formula | C19H14ClN2O5- |
| Molecular Weight | 385.78 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-[4-[(E)-3-(4-chloroanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2ccc(Cl)cc2)ccc1OCC(=O)[O-] |
| InChI | InChI=1S/C19H15ClN2O5/c1-26-17-9-12(2-7-16(17)27-11-18(23)24)8-13(10-21)19(25)22-15-5-3-14(20)4-6-15/h2-9H,11H2,1H3,(H,22,25)(H,23,24)/p-1/b13-8+ |
| InChIKey | XBIRTLNDSBEWLG-MDWZMJQESA-M |
| XLogP | 2.02 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.78 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|