C25H19ClN4O6 — CID 126230013
(E)-3-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126230013) has the molecular formula C25H19ClN4O6 and a molecular weight of 506.90 g/mol. Its IUPAC name is (E)-3-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126230013 |
| Molecular Formula | C25H19ClN4O6 |
| Molecular Weight | 506.90 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | (E)-3-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)ccc1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19ClN4O6/c1-35-23-12-16(5-10-22(23)36-15-24(31)28-19-8-6-18(26)7-9-19)11-17(14-27)25(32)29-20-3-2-4-21(13-20)30(33)34/h2-13H,15H2,1H3,(H,28,31)(H,29,32)/b17-11+ |
| InChIKey | IJKNNWLLVUNVMT-GZTJUZNOSA-N |
| XLogP | 4.82 |
| TPSA | 143.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.90 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|