C26H20ClIN4O6 — CID 126257759
(Z)-3-[4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126257759) has the molecular formula C26H20ClIN4O6 and a molecular weight of 646.83 g/mol. Its IUPAC name is (Z)-3-[4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126257759 |
| Molecular Formula | C26H20ClIN4O6 |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.01 |
| IUPAC Name | (Z)-3-[4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc(I)c1OCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C26H20ClIN4O6/c1-15-6-7-19(12-21(15)27)30-24(33)14-38-25-22(28)9-16(10-23(25)37-2)8-17(13-29)26(34)31-18-4-3-5-20(11-18)32(35)36/h3-12H,14H2,1-2H3,(H,30,33)(H,31,34)/b17-8- |
| InChIKey | PTZLNPWIHMAMIJ-IUXPMGMMSA-N |
| XLogP | 5.73 |
| TPSA | 143.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|