C24H16Cl2N4O5 — CID 126275555
(Z)-3-[4-(2-anilino-2-oxoethoxy)-3,5-dichlorophenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126275555) has the molecular formula C24H16Cl2N4O5 and a molecular weight of 511.32 g/mol. Its IUPAC name is (Z)-3-[4-(2-anilino-2-oxoethoxy)-3,5-dichlorophenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(2-anilino-2-oxoethoxy)-3,5-dichlorophenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126275555 |
| Molecular Formula | C24H16Cl2N4O5 |
| Molecular Weight | 511.32 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | (Z)-3-[4-(2-anilino-2-oxoethoxy)-3,5-dichlorophenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cc(Cl)c(OCC(=O)Nc2ccccc2)c(Cl)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H16Cl2N4O5/c25-20-10-15(9-16(13-27)24(32)29-18-7-4-8-19(12-18)30(33)34)11-21(26)23(20)35-14-22(31)28-17-5-2-1-3-6-17/h1-12H,14H2,(H,28,31)(H,29,32)/b16-9- |
| InChIKey | INSOLQXXIFCGFL-SXGWCWSVSA-N |
| XLogP | 5.46 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.32 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|