C18H12Cl2N4O5 — CID 126229036
(E)-3-[4-(2-amino-2-oxoethoxy)-3,5-dichlorophenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126229036) has the molecular formula C18H12Cl2N4O5 and a molecular weight of 435.22 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)-3,5-dichlorophenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3,5-dichlorophenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126229036 |
| Molecular Formula | C18H12Cl2N4O5 |
| Molecular Weight | 435.22 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3,5-dichlorophenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Cl)c(OCC(N)=O)c(Cl)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H12Cl2N4O5/c19-14-5-10(6-15(20)17(14)29-9-16(22)25)4-11(8-21)18(26)23-12-2-1-3-13(7-12)24(27)28/h1-7H,9H2,(H2,22,25)(H,23,26)/b11-4+ |
| InChIKey | FAPJAXHCTZMURM-NYYWCZLTSA-N |
| XLogP | 3.31 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|