C19H11Cl2N3O4 — CID 126051792
(E)-2-cyano-3-(3,5-dichloro-2-prop-2-ynoxyphenyl)-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126051792) has the molecular formula C19H11Cl2N3O4 and a molecular weight of 416.22 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,5-dichloro-2-prop-2-ynoxyphenyl)-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,5-dichloro-2-prop-2-ynoxyphenyl)-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126051792 |
| Molecular Formula | C19H11Cl2N3O4 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | (E)-2-cyano-3-(3,5-dichloro-2-prop-2-ynoxyphenyl)-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | C#CCOc1c(Cl)cc(Cl)cc1/C=C(\C#N)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H11Cl2N3O4/c1-2-6-28-18-12(8-14(20)9-17(18)21)7-13(11-22)19(25)23-15-4-3-5-16(10-15)24(26)27/h1,3-5,7-10H,6H2,(H,23,25)/b13-7+ |
| InChIKey | GMKODBQLHGMOBG-NTUHNPAUSA-N |
| XLogP | 4.46 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|