C25H18Cl2N4O5 — CID 126267558
(Z)-3-[5-chloro-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126267558) has the molecular formula C25H18Cl2N4O5 and a molecular weight of 525.35 g/mol. Its IUPAC name is (Z)-3-[5-chloro-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[5-chloro-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126267558 |
| Molecular Formula | C25H18Cl2N4O5 |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | (Z)-3-[5-chloro-2-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(Cl)cc2/C=C(/C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc1Cl |
| InChI | InChI=1S/C25H18Cl2N4O5/c1-15-5-7-20(12-22(15)27)29-24(32)14-36-23-8-6-18(26)10-16(23)9-17(13-28)25(33)30-19-3-2-4-21(11-19)31(34)35/h2-12H,14H2,1H3,(H,29,32)(H,30,33)/b17-9- |
| InChIKey | BEBKXGALWHQEBS-MFOYZWKCSA-N |
| XLogP | 5.77 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|