C24H16ClFN4O5 — CID 126382985
(Z)-3-[5-chloro-2-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126382985) has the molecular formula C24H16ClFN4O5 and a molecular weight of 494.87 g/mol. Its IUPAC name is (Z)-3-[5-chloro-2-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[5-chloro-2-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126382985 |
| Molecular Formula | C24H16ClFN4O5 |
| Molecular Weight | 494.87 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (Z)-3-[5-chloro-2-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cc(Cl)ccc1OCC(=O)Nc1ccccc1F)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H16ClFN4O5/c25-17-8-9-22(35-14-23(31)29-21-7-2-1-6-20(21)26)15(11-17)10-16(13-27)24(32)28-18-4-3-5-19(12-18)30(33)34/h1-12H,14H2,(H,28,32)(H,29,31)/b16-10- |
| InChIKey | OUUBWYXRCLTLEG-YBEGLDIGSA-N |
| XLogP | 4.95 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.87 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|