C24H17ClN4O5 — CID 4710762
3-[2-(2-anilino-2-oxoethoxy)phenyl]-N-(2-chloro-4-nitrophenyl)-2-cyanoprop-2-enamide (PubChem CID 4710762) has the molecular formula C24H17ClN4O5 and a molecular weight of 476.88 g/mol. Its IUPAC name is 3-[2-(2-anilino-2-oxoethoxy)phenyl]-N-(2-chloro-4-nitrophenyl)-2-cyanoprop-2-enamide.
| Compound Name | 3-[2-(2-anilino-2-oxoethoxy)phenyl]-N-(2-chloro-4-nitrophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 4710762 |
| Molecular Formula | C24H17ClN4O5 |
| Molecular Weight | 476.88 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 3-[2-(2-anilino-2-oxoethoxy)phenyl]-N-(2-chloro-4-nitrophenyl)-2-cyanoprop-2-enamide |
| SMILES | N#CC(=Cc1ccccc1OCC(=O)Nc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C24H17ClN4O5/c25-20-13-19(29(32)33)10-11-21(20)28-24(31)17(14-26)12-16-6-4-5-9-22(16)34-15-23(30)27-18-7-2-1-3-8-18/h1-13H,15H2,(H,27,30)(H,28,31) |
| InChIKey | LMMSMGXRQJNORJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|