C25H17ClF3N3O3 — CID 4710757
3-[2-(2-anilino-2-oxoethoxy)phenyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide (PubChem CID 4710757) has the molecular formula C25H17ClF3N3O3 and a molecular weight of 499.88 g/mol. Its IUPAC name is 3-[2-(2-anilino-2-oxoethoxy)phenyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide.
| Compound Name | 3-[2-(2-anilino-2-oxoethoxy)phenyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 4710757 |
| Molecular Formula | C25H17ClF3N3O3 |
| Molecular Weight | 499.88 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 3-[2-(2-anilino-2-oxoethoxy)phenyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
| SMILES | N#CC(=Cc1ccccc1OCC(=O)Nc1ccccc1)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H17ClF3N3O3/c26-21-11-10-19(13-20(21)25(27,28)29)32-24(34)17(14-30)12-16-6-4-5-9-22(16)35-15-23(33)31-18-7-2-1-3-8-18/h1-13H,15H2,(H,31,33)(H,32,34) |
| InChIKey | KUGRBEFCOFWZDI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.88 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|