C25H17Cl3N4O5 — CID 126272541
(Z)-2-cyano-3-[3,5-dichloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126272541) has the molecular formula C25H17Cl3N4O5 and a molecular weight of 559.79 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3,5-dichloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3,5-dichloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126272541 |
| Molecular Formula | C25H17Cl3N4O5 |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | (Z)-2-cyano-3-[3,5-dichloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Cl)cc(/C=C(/C#N)C(=O)Nc3cccc([N+](=O)[O-])c3)cc2Cl)cc1Cl |
| InChI | InChI=1S/C25H17Cl3N4O5/c1-14-5-6-18(11-20(14)26)30-23(33)13-37-24-21(27)8-15(9-22(24)28)7-16(12-29)25(34)31-17-3-2-4-19(10-17)32(35)36/h2-11H,13H2,1H3,(H,30,33)(H,31,34)/b16-7- |
| InChIKey | RACZIOQXNDHFTH-APSNUPSMSA-N |
| XLogP | 6.43 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|