C27H22Cl3N3O3 — CID 126270799
(E)-2-cyano-3-[3,5-dichloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 126270799) has the molecular formula C27H22Cl3N3O3 and a molecular weight of 542.85 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dichloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dichloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126270799 |
| Molecular Formula | C27H22Cl3N3O3 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dichloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/c2cc(Cl)c(OCC(=O)Nc3ccc(C)c(Cl)c3)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C27H22Cl3N3O3/c1-15-4-7-24(17(3)8-15)33-27(35)19(13-31)9-18-10-22(29)26(23(30)11-18)36-14-25(34)32-20-6-5-16(2)21(28)12-20/h4-12H,14H2,1-3H3,(H,32,34)(H,33,35)/b19-9+ |
| InChIKey | QLGUBYTUPOCYDX-DJKKODMXSA-N |
| XLogP | 7.14 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|