C27H20Cl3N3O5 — CID 126264847
methyl 4-[[(Z)-2-cyano-3-[3,5-dichloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate (PubChem CID 126264847) has the molecular formula C27H20Cl3N3O5 and a molecular weight of 572.83 g/mol. Its IUPAC name is methyl 4-[[(Z)-2-cyano-3-[3,5-dichloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-2-cyano-3-[3,5-dichloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 126264847 |
| Molecular Formula | C27H20Cl3N3O5 |
| Molecular Weight | 572.83 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | methyl 4-[[(Z)-2-cyano-3-[3,5-dichloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)/C(C#N)=C\c2cc(Cl)c(OCC(=O)Nc3ccc(C)c(Cl)c3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H20Cl3N3O5/c1-15-3-6-20(12-21(15)28)32-24(34)14-38-25-22(29)10-16(11-23(25)30)9-18(13-31)26(35)33-19-7-4-17(5-8-19)27(36)37-2/h3-12H,14H2,1-2H3,(H,32,34)(H,33,35)/b18-9- |
| InChIKey | YQHOPUKKRWTYLN-NVMNQCDNSA-N |
| XLogP | 6.30 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.83 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|