C28H24ClN3O6 — CID 126259281
methyl 4-[[(Z)-3-[3-chloro-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 126259281) has the molecular formula C28H24ClN3O6 and a molecular weight of 533.97 g/mol. Its IUPAC name is methyl 4-[[(Z)-3-[3-chloro-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-3-[3-chloro-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 126259281 |
| Molecular Formula | C28H24ClN3O6 |
| Molecular Weight | 533.97 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | methyl 4-[[(Z)-3-[3-chloro-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)/C(C#N)=C\c2cc(Cl)c(OCC(=O)Nc3ccccc3C)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H24ClN3O6/c1-17-6-4-5-7-23(17)32-25(33)16-38-26-22(29)13-18(14-24(26)36-2)12-20(15-30)27(34)31-21-10-8-19(9-11-21)28(35)37-3/h4-14H,16H2,1-3H3,(H,31,34)(H,32,33)/b20-12- |
| InChIKey | VVEKDWWEWFRXIZ-NDENLUEZSA-N |
| XLogP | 5.01 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.97 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|