C26H21Cl2N3O4 — CID 126272299
(Z)-3-[3-chloro-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 126272299) has the molecular formula C26H21Cl2N3O4 and a molecular weight of 510.38 g/mol. Its IUPAC name is (Z)-3-[3-chloro-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[3-chloro-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126272299 |
| Molecular Formula | C26H21Cl2N3O4 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | (Z)-3-[3-chloro-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2cccc(Cl)c2)cc(Cl)c1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C26H21Cl2N3O4/c1-16-6-3-4-9-22(16)31-24(32)15-35-25-21(28)11-17(12-23(25)34-2)10-18(14-29)26(33)30-20-8-5-7-19(27)13-20/h3-13H,15H2,1-2H3,(H,30,33)(H,31,32)/b18-10- |
| InChIKey | JUBSJRHMZVCCMK-ZDLGFXPLSA-N |
| XLogP | 5.87 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|