C25H19Cl2N3O4 — CID 27129786
(E)-3-[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 27129786) has the molecular formula C25H19Cl2N3O4 and a molecular weight of 496.35 g/mol. Its IUPAC name is (E)-3-[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 27129786 |
| Molecular Formula | C25H19Cl2N3O4 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | (E)-3-[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2cccc(Cl)c2)ccc1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C25H19Cl2N3O4/c1-33-23-12-16(11-17(14-28)25(32)29-19-6-4-5-18(26)13-19)9-10-22(23)34-15-24(31)30-21-8-3-2-7-20(21)27/h2-13H,15H2,1H3,(H,29,32)(H,30,31)/b17-11+ |
| InChIKey | PTSRDLZGFANGAH-GZTJUZNOSA-N |
| XLogP | 5.57 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|