C25H18Br2ClN3O4 — CID 126260606
(E)-2-cyano-3-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 126260606) has the molecular formula C25H18Br2ClN3O4 and a molecular weight of 619.70 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126260606 |
| Molecular Formula | C25H18Br2ClN3O4 |
| Molecular Weight | 619.70 g/mol |
| Exact Mass | 616.94 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Br)cc(/C=C(\C#N)C(=O)Nc3ccc(O)cc3)cc2Br)cc1Cl |
| InChI | InChI=1S/C25H18Br2ClN3O4/c1-14-2-3-18(11-22(14)28)30-23(33)13-35-24-20(26)9-15(10-21(24)27)8-16(12-29)25(34)31-17-4-6-19(32)7-5-17/h2-11,32H,13H2,1H3,(H,30,33)(H,31,34)/b16-8+ |
| InChIKey | DGSCQALYGABXGW-LZYBPNLTSA-N |
| XLogP | 6.44 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.70 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|