C26H17Br2ClF3N3O3 — CID 126273595
(E)-2-cyano-3-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126273595) has the molecular formula C26H17Br2ClF3N3O3 and a molecular weight of 671.70 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126273595 |
| Molecular Formula | C26H17Br2ClF3N3O3 |
| Molecular Weight | 671.70 g/mol |
| Exact Mass | 668.93 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dibromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Br)cc(/C=C(\C#N)C(=O)Nc3cccc(C(F)(F)F)c3)cc2Br)cc1Cl |
| InChI | InChI=1S/C26H17Br2ClF3N3O3/c1-14-5-6-19(11-22(14)29)34-23(36)13-38-24-20(27)8-15(9-21(24)28)7-16(12-33)25(37)35-18-4-2-3-17(10-18)26(30,31)32/h2-11H,13H2,1H3,(H,34,36)(H,35,37)/b16-7+ |
| InChIKey | URXBYFFKPOEBJA-FRKPEAEDSA-N |
| XLogP | 7.76 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.70 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|