C27H21BrF3N3O4 — CID 126055165
(E)-3-[3-bromo-5-methoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126055165) has the molecular formula C27H21BrF3N3O4 and a molecular weight of 588.38 g/mol. Its IUPAC name is (E)-3-[3-bromo-5-methoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-5-methoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126055165 |
| Molecular Formula | C27H21BrF3N3O4 |
| Molecular Weight | 588.38 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | (E)-3-[3-bromo-5-methoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2cccc(C(F)(F)F)c2)cc(Br)c1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C27H21BrF3N3O4/c1-16-5-3-7-20(9-16)33-24(35)15-38-25-22(28)11-17(12-23(25)37-2)10-18(14-32)26(36)34-21-8-4-6-19(13-21)27(29,30)31/h3-13H,15H2,1-2H3,(H,33,35)(H,34,36)/b18-10+ |
| InChIKey | TVEDVGXVOWBNPT-VCHYOVAHSA-N |
| XLogP | 6.35 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.38 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|