C26H17BrF3N3O3 — CID 126239080
(Z)-3-[3-bromo-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126239080) has the molecular formula C26H17BrF3N3O3 and a molecular weight of 556.34 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126239080 |
| Molecular Formula | C26H17BrF3N3O3 |
| Molecular Weight | 556.34 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | (Z)-3-[3-bromo-4-[(2-cyanophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2cccc(C(F)(F)F)c2)cc(Br)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C26H17BrF3N3O3/c1-35-23-11-16(10-22(27)24(23)36-15-18-6-3-2-5-17(18)13-31)9-19(14-32)25(34)33-21-8-4-7-20(12-21)26(28,29)30/h2-12H,15H2,1H3,(H,33,34)/b19-9- |
| InChIKey | IXOKTQWKJIMCSL-OCKHKDLRSA-N |
| XLogP | 6.47 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.34 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|