C32H25F3N2O3 — CID 126075326
(E)-2-cyano-3-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126075326) has the molecular formula C32H25F3N2O3 and a molecular weight of 542.56 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126075326 |
| Molecular Formula | C32H25F3N2O3 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | (E)-2-cyano-3-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2cccc(C(F)(F)F)c2)cc(OC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C32H25F3N2O3/c1-3-8-23-15-21(16-25(19-36)31(38)37-27-13-7-12-26(18-27)32(33,34)35)17-29(39-2)30(23)40-20-24-11-6-10-22-9-4-5-14-28(22)24/h3-7,9-18H,1,8,20H2,2H3,(H,37,38)/b25-16+ |
| InChIKey | UWPKDIJOEHBDOV-PCLIKHOPSA-N |
| XLogP | 7.72 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|