C29H27ClN2O4 — CID 126076871
(E)-3-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide (PubChem CID 126076871) has the molecular formula C29H27ClN2O4 and a molecular weight of 503.00 g/mol. Its IUPAC name is (E)-3-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126076871 |
| Molecular Formula | C29H27ClN2O4 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | (E)-3-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2ccc(OC)cc2)cc(OCC)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C29H27ClN2O4/c1-4-8-21-15-20(16-23(18-31)29(33)32-24-11-13-25(34-3)14-12-24)17-27(35-5-2)28(21)36-19-22-9-6-7-10-26(22)30/h4,6-7,9-17H,1,5,8,19H2,2-3H3,(H,32,33)/b23-16+ |
| InChIKey | YNQLXPXWFZCZMP-XQNSMLJCSA-N |
| XLogP | 6.60 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|