C34H30N2O5 — CID 126079548
methyl 4-[[(E)-2-cyano-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]prop-2-enoyl]amino]benzoate (PubChem CID 126079548) has the molecular formula C34H30N2O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is methyl 4-[[(E)-2-cyano-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(E)-2-cyano-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 126079548 |
| Molecular Formula | C34H30N2O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | methyl 4-[[(E)-2-cyano-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]prop-2-enoyl]amino]benzoate |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2ccc(C(=O)OC)cc2)cc(OCC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C34H30N2O5/c1-4-9-26-18-23(19-28(21-35)33(37)36-29-16-14-25(15-17-29)34(38)39-3)20-31(40-5-2)32(26)41-22-27-12-8-11-24-10-6-7-13-30(24)27/h4,6-8,10-20H,1,5,9,22H2,2-3H3,(H,36,37)/b28-19+ |
| InChIKey | VIFGBFSVURJRIV-TURZUDJPSA-N |
| XLogP | 6.88 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|