C31H27BrN2O3 — CID 21234560
(E)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(4-ethylphenyl)prop-2-enamide (PubChem CID 21234560) has the molecular formula C31H27BrN2O3 and a molecular weight of 555.47 g/mol. Its IUPAC name is (E)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(4-ethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(4-ethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 21234560 |
| Molecular Formula | C31H27BrN2O3 |
| Molecular Weight | 555.47 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | (E)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(4-ethylphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2ccc(CC)cc2)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C31H27BrN2O3/c1-3-21-12-14-26(15-13-21)34-31(35)25(19-33)16-22-17-28(32)30(29(18-22)36-4-2)37-20-24-10-7-9-23-8-5-6-11-27(23)24/h5-18H,3-4,20H2,1-2H3,(H,34,35)/b25-16+ |
| InChIKey | PPTZDXAWTGSQEG-PCLIKHOPSA-N |
| XLogP | 7.69 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.47 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|