C29H26BrN3O3 — CID 126382738
(Z)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide (PubChem CID 126382738) has the molecular formula C29H26BrN3O3 and a molecular weight of 544.45 g/mol. Its IUPAC name is (Z)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 126382738 |
| Molecular Formula | C29H26BrN3O3 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | (Z)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nn2c(C)ccc2C)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H26BrN3O3/c1-4-35-27-16-21(14-24(17-31)29(34)32-33-19(2)12-13-20(33)3)15-26(30)28(27)36-18-23-10-7-9-22-8-5-6-11-25(22)23/h5-16H,4,18H2,1-3H3,(H,32,34)/b24-14- |
| InChIKey | MTTZJZYRJMAYQJ-OYKKKHCWSA-N |
| XLogP | 6.68 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|